C16H23Cl2N — CID 81025276
N-[[2-(2,3-dichlorophenyl)cycloheptyl]methyl]ethanamine (PubChem CID 81025276) has the molecular formula C16H23Cl2N and a molecular weight of 300.27 g/mol. Its IUPAC name is N-[[2-(2,3-dichlorophenyl)cycloheptyl]methyl]ethanamine.
| Compound Name | N-[[2-(2,3-dichlorophenyl)cycloheptyl]methyl]ethanamine |
|---|---|
| PubChem CID | 81025276 |
| Molecular Formula | C16H23Cl2N |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-[[2-(2,3-dichlorophenyl)cycloheptyl]methyl]ethanamine |
| SMILES | CCNCC1CCCCCC1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H23Cl2N/c1-2-19-11-12-7-4-3-5-8-13(12)14-9-6-10-15(17)16(14)18/h6,9-10,12-13,19H,2-5,7-8,11H2,1H3 |
| InChIKey | IGSPBZKBEDHACT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |