C17H23F2N — CID 81026617
N-[[2-(2,4-difluorophenyl)cycloheptyl]methyl]cyclopropanamine (PubChem CID 81026617) has the molecular formula C17H23F2N and a molecular weight of 279.37 g/mol. Its IUPAC name is N-[[2-(2,4-difluorophenyl)cycloheptyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(2,4-difluorophenyl)cycloheptyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 81026617 |
| Molecular Formula | C17H23F2N |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | N-[[2-(2,4-difluorophenyl)cycloheptyl]methyl]cyclopropanamine |
| SMILES | Fc1ccc(C2CCCCCC2CNC2CC2)c(F)c1 |
| InChI | InChI=1S/C17H23F2N/c18-13-6-9-16(17(19)10-13)15-5-3-1-2-4-12(15)11-20-14-7-8-14/h6,9-10,12,14-15,20H,1-5,7-8,11H2 |
| InChIKey | QXJDFXGOYHGQRU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |