About N-[[2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopentyl]methyl]cyclopropanamine
N-[[2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopentyl]methyl]cyclopropanamine (PubChem CID 81027517) has the molecular formula C18H25NS
and a molecular weight of 287.47 g/mol. Its IUPAC name is N-[[2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopentyl]methyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[[2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopentyl]methyl]cyclopropanamine |
| PubChem CID | 81027517 |
| Molecular Formula | C18H25NS |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-[[2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopentyl]methyl]cyclopropanamine |
| SMILES | c1ccc2c(c1)CC(CC1CCCC1CNC1CC1)S2 |
| InChI | InChI=1S/C18H25NS/c1-2-7-18-14(4-1)11-17(20-18)10-13-5-3-6-15(13)12-19-16-8-9-16/h1-2,4,7,13,15-17,19H,3,5-6,8-12H2 |
| InChIKey | ZPGMGDJEAXHUHJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopentyl]methyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopentyl]methyl]cyclopropanamine?
The IUPAC name of N-[[2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopentyl]methyl]cyclopropanamine (CID 81027517) is N-[[2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopentyl]methyl]cyclopropanamine.
What is the SMILES notation for N-[[2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopentyl]methyl]cyclopropanamine?
The canonical SMILES for N-[[2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopentyl]methyl]cyclopropanamine is c1ccc2c(c1)CC(CC1CCCC1CNC1CC1)S2.
What is the InChIKey of N-[[2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopentyl]methyl]cyclopropanamine?
The InChIKey is ZPGMGDJEAXHUHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NS/c1-2-7-18-14(4-1)11-17(20-18)10-13-5-3-6-15(13)12-19-16-8-9-16/h1-2,4,7,13,15-17,19H,3,5-6,8-12H2.
What are the key properties of N-[[2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopentyl]methyl]cyclopropanamine?
N-[[2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopentyl]methyl]cyclopropanamine has a molecular weight of 287.47 g/mol, XLogP of 4.26, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopentyl]methyl]cyclopropanamine is sourced from PubChem (CID 81027517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).