C18H29NO2 — CID 81028647
1-[2-(3,4-diethoxyphenyl)cyclohexyl]-N-methylmethanamine (PubChem CID 81028647) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)cyclohexyl]-N-methylmethanamine.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)cyclohexyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 81028647 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)cyclohexyl]-N-methylmethanamine |
| SMILES | CCOc1ccc(C2CCCCC2CNC)cc1OCC |
| InChI | InChI=1S/C18H29NO2/c1-4-20-17-11-10-14(12-18(17)21-5-2)16-9-7-6-8-15(16)13-19-3/h10-12,15-16,19H,4-9,13H2,1-3H3 |
| InChIKey | VSVGZCIMHCESBJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |