C15H29N — CID 81029231
N-methyl-1-[2-(2-methylprop-2-enyl)-4-propylcyclohexyl]methanamine (PubChem CID 81029231) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is N-methyl-1-[2-(2-methylprop-2-enyl)-4-propylcyclohexyl]methanamine.
| Compound Name | N-methyl-1-[2-(2-methylprop-2-enyl)-4-propylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 81029231 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | N-methyl-1-[2-(2-methylprop-2-enyl)-4-propylcyclohexyl]methanamine |
| SMILES | C=C(C)CC1CC(CCC)CCC1CNC |
| InChI | InChI=1S/C15H29N/c1-5-6-13-7-8-14(11-16-4)15(10-13)9-12(2)3/h13-16H,2,5-11H2,1,3-4H3 |
| InChIKey | MOQXBDVTGOKAPU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|