C19H39N — CID 81030002
N-[[2-(3,3-dimethylbutyl)-4-propan-2-ylcyclohexyl]methyl]propan-1-amine (PubChem CID 81030002) has the molecular formula C19H39N and a molecular weight of 281.53 g/mol. Its IUPAC name is N-[[2-(3,3-dimethylbutyl)-4-propan-2-ylcyclohexyl]methyl]propan-1-amine.
| Compound Name | N-[[2-(3,3-dimethylbutyl)-4-propan-2-ylcyclohexyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 81030002 |
| Molecular Formula | C19H39N |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 281.31 |
| IUPAC Name | N-[[2-(3,3-dimethylbutyl)-4-propan-2-ylcyclohexyl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCC(C(C)C)CC1CCC(C)(C)C |
| InChI | InChI=1S/C19H39N/c1-7-12-20-14-18-9-8-16(15(2)3)13-17(18)10-11-19(4,5)6/h15-18,20H,7-14H2,1-6H3 |
| InChIKey | WBZSQYHHIKLWTB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|