C19H39N — CID 81030393
N-[[4-tert-butyl-2-(2-methylbutyl)cyclohexyl]methyl]propan-2-amine (PubChem CID 81030393) has the molecular formula C19H39N and a molecular weight of 281.53 g/mol. Its IUPAC name is N-[[4-tert-butyl-2-(2-methylbutyl)cyclohexyl]methyl]propan-2-amine.
| Compound Name | N-[[4-tert-butyl-2-(2-methylbutyl)cyclohexyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 81030393 |
| Molecular Formula | C19H39N |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 281.31 |
| IUPAC Name | N-[[4-tert-butyl-2-(2-methylbutyl)cyclohexyl]methyl]propan-2-amine |
| SMILES | CCC(C)CC1CC(C(C)(C)C)CCC1CNC(C)C |
| InChI | InChI=1S/C19H39N/c1-8-15(4)11-17-12-18(19(5,6)7)10-9-16(17)13-20-14(2)3/h14-18,20H,8-13H2,1-7H3 |
| InChIKey | VFYVALDWTVKFTA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |