C19H35N — CID 81030395
N-[[4-tert-butyl-2-(2-methylidenebutyl)cyclohexyl]methyl]cyclopropanamine (PubChem CID 81030395) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is N-[[4-tert-butyl-2-(2-methylidenebutyl)cyclohexyl]methyl]cyclopropanamine.
| Compound Name | N-[[4-tert-butyl-2-(2-methylidenebutyl)cyclohexyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 81030395 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | N-[[4-tert-butyl-2-(2-methylidenebutyl)cyclohexyl]methyl]cyclopropanamine |
| SMILES | C=C(CC)CC1CC(C(C)(C)C)CCC1CNC1CC1 |
| InChI | InChI=1S/C19H35N/c1-6-14(2)11-16-12-17(19(3,4)5)8-7-15(16)13-20-18-9-10-18/h15-18,20H,2,6-13H2,1,3-5H3 |
| InChIKey | QMBHACCEGVWELD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|