About N-[[2-(3-chlorophenyl)-4,4-dimethylcyclohexyl]methyl]propan-1-amine
N-[[2-(3-chlorophenyl)-4,4-dimethylcyclohexyl]methyl]propan-1-amine (PubChem CID 81030568) has the molecular formula C18H28ClN
and a molecular weight of 293.88 g/mol. Its IUPAC name is N-[[2-(3-chlorophenyl)-4,4-dimethylcyclohexyl]methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[[2-(3-chlorophenyl)-4,4-dimethylcyclohexyl]methyl]propan-1-amine |
| PubChem CID | 81030568 |
| Molecular Formula | C18H28ClN |
| Molecular Weight | 293.88 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N-[[2-(3-chlorophenyl)-4,4-dimethylcyclohexyl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCC(C)(C)CC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H28ClN/c1-4-10-20-13-15-8-9-18(2,3)12-17(15)14-6-5-7-16(19)11-14/h5-7,11,15,17,20H,4,8-10,12-13H2,1-3H3 |
| InChIKey | FVNOLKBOECXHGK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.88 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[2-(3-chlorophenyl)-4,4-dimethylcyclohexyl]methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(3-chlorophenyl)-4,4-dimethylcyclohexyl]methyl]propan-1-amine?
The IUPAC name of N-[[2-(3-chlorophenyl)-4,4-dimethylcyclohexyl]methyl]propan-1-amine (CID 81030568) is N-[[2-(3-chlorophenyl)-4,4-dimethylcyclohexyl]methyl]propan-1-amine.
What is the SMILES notation for N-[[2-(3-chlorophenyl)-4,4-dimethylcyclohexyl]methyl]propan-1-amine?
The canonical SMILES for N-[[2-(3-chlorophenyl)-4,4-dimethylcyclohexyl]methyl]propan-1-amine is CCCNCC1CCC(C)(C)CC1c1cccc(Cl)c1.
What is the InChIKey of N-[[2-(3-chlorophenyl)-4,4-dimethylcyclohexyl]methyl]propan-1-amine?
The InChIKey is FVNOLKBOECXHGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28ClN/c1-4-10-20-13-15-8-9-18(2,3)12-17(15)14-6-5-7-16(19)11-14/h5-7,11,15,17,20H,4,8-10,12-13H2,1-3H3.
What are the key properties of N-[[2-(3-chlorophenyl)-4,4-dimethylcyclohexyl]methyl]propan-1-amine?
N-[[2-(3-chlorophenyl)-4,4-dimethylcyclohexyl]methyl]propan-1-amine has a molecular weight of 293.88 g/mol, XLogP of 5.25, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(3-chlorophenyl)-4,4-dimethylcyclohexyl]methyl]propan-1-amine is sourced from PubChem (CID 81030568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).