C15H25NS — CID 81032227
1-[4-ethyl-2-(5-methylthiophen-2-yl)cyclohexyl]-N-methylmethanamine (PubChem CID 81032227) has the molecular formula C15H25NS and a molecular weight of 251.44 g/mol. Its IUPAC name is 1-[4-ethyl-2-(5-methylthiophen-2-yl)cyclohexyl]-N-methylmethanamine.
| Compound Name | 1-[4-ethyl-2-(5-methylthiophen-2-yl)cyclohexyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 81032227 |
| Molecular Formula | C15H25NS |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 1-[4-ethyl-2-(5-methylthiophen-2-yl)cyclohexyl]-N-methylmethanamine |
| SMILES | CCC1CCC(CNC)C(c2ccc(C)s2)C1 |
| InChI | InChI=1S/C15H25NS/c1-4-12-6-7-13(10-16-3)14(9-12)15-8-5-11(2)17-15/h5,8,12-14,16H,4,6-7,9-10H2,1-3H3 |
| InChIKey | ZCLQRVCAHRBBSI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |