C19H30FN — CID 81033689
N-[[4-ethyl-2-[(4-fluorophenyl)methyl]cyclohexyl]methyl]propan-2-amine (PubChem CID 81033689) has the molecular formula C19H30FN and a molecular weight of 291.45 g/mol. Its IUPAC name is N-[[4-ethyl-2-[(4-fluorophenyl)methyl]cyclohexyl]methyl]propan-2-amine.
| Compound Name | N-[[4-ethyl-2-[(4-fluorophenyl)methyl]cyclohexyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 81033689 |
| Molecular Formula | C19H30FN |
| Molecular Weight | 291.45 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | N-[[4-ethyl-2-[(4-fluorophenyl)methyl]cyclohexyl]methyl]propan-2-amine |
| SMILES | CCC1CCC(CNC(C)C)C(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H30FN/c1-4-15-5-8-17(13-21-14(2)3)18(11-15)12-16-6-9-19(20)10-7-16/h6-7,9-10,14-15,17-18,21H,4-5,8,11-13H2,1-3H3 |
| InChIKey | XJKKUKOQPMKHJM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |