About N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclopentyl]methanamine
N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclopentyl]methanamine (PubChem CID 81034120) has the molecular formula C13H16F3N
and a molecular weight of 243.27 g/mol. Its IUPAC name is N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclopentyl]methanamine.
Molecular Properties
| Compound Name | N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclopentyl]methanamine |
| PubChem CID | 81034120 |
| Molecular Formula | C13H16F3N |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclopentyl]methanamine |
| SMILES | CNCC1CCCC1c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H16F3N/c1-17-7-8-3-2-4-9(8)10-5-6-11(14)13(16)12(10)15/h5-6,8-9,17H,2-4,7H2,1H3 |
| InChIKey | DITJJDACXIRUAC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclopentyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclopentyl]methanamine?
The IUPAC name of N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclopentyl]methanamine (CID 81034120) is N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclopentyl]methanamine.
What is the SMILES notation for N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclopentyl]methanamine?
The canonical SMILES for N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclopentyl]methanamine is CNCC1CCCC1c1ccc(F)c(F)c1F.
What is the InChIKey of N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclopentyl]methanamine?
The InChIKey is DITJJDACXIRUAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3N/c1-17-7-8-3-2-4-9(8)10-5-6-11(14)13(16)12(10)15/h5-6,8-9,17H,2-4,7H2,1H3.
What are the key properties of N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclopentyl]methanamine?
N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclopentyl]methanamine has a molecular weight of 243.27 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclopentyl]methanamine is sourced from PubChem (CID 81034120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).