About 3-amino-N-cyclopropyl-N-(2-hydroxyethyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide
3-amino-N-cyclopropyl-N-(2-hydroxyethyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide (PubChem CID 81035171) has the molecular formula C15H19N3O2S
and a molecular weight of 305.40 g/mol. Its IUPAC name is 3-amino-N-cyclopropyl-N-(2-hydroxyethyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N-cyclopropyl-N-(2-hydroxyethyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide |
| PubChem CID | 81035171 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-amino-N-cyclopropyl-N-(2-hydroxyethyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide |
| SMILES | Cc1cc2sc(C(=O)N(CCO)C3CC3)c(N)c2c(C)n1 |
| InChI | InChI=1S/C15H19N3O2S/c1-8-7-11-12(9(2)17-8)13(16)14(21-11)15(20)18(5-6-19)10-3-4-10/h7,10,19H,3-6,16H2,1-2H3 |
| InChIKey | NIRJZDWULUKSQV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-N-cyclopropyl-N-(2-hydroxyethyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-cyclopropyl-N-(2-hydroxyethyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide?
The IUPAC name of 3-amino-N-cyclopropyl-N-(2-hydroxyethyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide (CID 81035171) is 3-amino-N-cyclopropyl-N-(2-hydroxyethyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide.
What is the SMILES notation for 3-amino-N-cyclopropyl-N-(2-hydroxyethyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide?
The canonical SMILES for 3-amino-N-cyclopropyl-N-(2-hydroxyethyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide is Cc1cc2sc(C(=O)N(CCO)C3CC3)c(N)c2c(C)n1.
What is the InChIKey of 3-amino-N-cyclopropyl-N-(2-hydroxyethyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide?
The InChIKey is NIRJZDWULUKSQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2S/c1-8-7-11-12(9(2)17-8)13(16)14(21-11)15(20)18(5-6-19)10-3-4-10/h7,10,19H,3-6,16H2,1-2H3.
What are the key properties of 3-amino-N-cyclopropyl-N-(2-hydroxyethyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide?
3-amino-N-cyclopropyl-N-(2-hydroxyethyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide has a molecular weight of 305.40 g/mol, XLogP of 2.09, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-cyclopropyl-N-(2-hydroxyethyl)-4,6-dimethylthieno[3,2-c]pyridine-2-carboxamide is sourced from PubChem (CID 81035171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).