C8H10Cl2N4 — CID 81035319
3,6-dichloro-N-cyclopentyl-1,2,4-triazin-5-amine (PubChem CID 81035319) has the molecular formula C8H10Cl2N4 and a molecular weight of 233.10 g/mol. Its IUPAC name is 3,6-dichloro-N-cyclopentyl-1,2,4-triazin-5-amine.
| Compound Name | 3,6-dichloro-N-cyclopentyl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 81035319 |
| Molecular Formula | C8H10Cl2N4 |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 3,6-dichloro-N-cyclopentyl-1,2,4-triazin-5-amine |
| SMILES | Clc1nnc(Cl)c(NC2CCCC2)n1 |
| InChI | InChI=1S/C8H10Cl2N4/c9-6-7(12-8(10)14-13-6)11-5-3-1-2-4-5/h5H,1-4H2,(H,11,12,14) |
| InChIKey | GKTQSRFGHXVHGJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |