C10H10Cl2N6S — CID 81035593
3-[(3,6-dichloro-1,2,4-triazin-5-yl)sulfanyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine (PubChem CID 81035593) has the molecular formula C10H10Cl2N6S and a molecular weight of 317.21 g/mol. Its IUPAC name is 3-[(3,6-dichloro-1,2,4-triazin-5-yl)sulfanyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine.
| Compound Name | 3-[(3,6-dichloro-1,2,4-triazin-5-yl)sulfanyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
|---|---|
| PubChem CID | 81035593 |
| Molecular Formula | C10H10Cl2N6S |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 3-[(3,6-dichloro-1,2,4-triazin-5-yl)sulfanyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
| SMILES | Clc1nnc(Cl)c(Sc2nnc3n2CCCCC3)n1 |
| InChI | InChI=1S/C10H10Cl2N6S/c11-7-8(13-9(12)16-15-7)19-10-17-14-6-4-2-1-3-5-18(6)10/h1-5H2 |
| InChIKey | UPWBFQBNEIGANL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |