C7H7Cl2N5O — CID 81036069
4-(3,6-dichloro-1,2,4-triazin-5-yl)piperazin-2-one (PubChem CID 81036069) has the molecular formula C7H7Cl2N5O and a molecular weight of 248.07 g/mol. Its IUPAC name is 4-(3,6-dichloro-1,2,4-triazin-5-yl)piperazin-2-one.
| Compound Name | 4-(3,6-dichloro-1,2,4-triazin-5-yl)piperazin-2-one |
|---|---|
| PubChem CID | 81036069 |
| Molecular Formula | C7H7Cl2N5O |
| Molecular Weight | 248.07 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 4-(3,6-dichloro-1,2,4-triazin-5-yl)piperazin-2-one |
| SMILES | O=C1CN(c2nc(Cl)nnc2Cl)CCN1 |
| InChI | InChI=1S/C7H7Cl2N5O/c8-5-6(11-7(9)13-12-5)14-2-1-10-4(15)3-14/h1-3H2,(H,10,15) |
| InChIKey | LUUSTOKAHADMEA-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.07 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |