About 3,6-dichloro-5-[3-(trifluoromethyl)pyrazol-1-yl]-1,2,4-triazine
3,6-dichloro-5-[3-(trifluoromethyl)pyrazol-1-yl]-1,2,4-triazine (PubChem CID 81036576) has the molecular formula C7H2Cl2F3N5
and a molecular weight of 284.03 g/mol. Its IUPAC name is 3,6-dichloro-5-[3-(trifluoromethyl)pyrazol-1-yl]-1,2,4-triazine.
Molecular Properties
| Compound Name | 3,6-dichloro-5-[3-(trifluoromethyl)pyrazol-1-yl]-1,2,4-triazine |
| PubChem CID | 81036576 |
| Molecular Formula | C7H2Cl2F3N5 |
| Molecular Weight | 284.03 g/mol |
| Exact Mass | 282.96 |
| IUPAC Name | 3,6-dichloro-5-[3-(trifluoromethyl)pyrazol-1-yl]-1,2,4-triazine |
| SMILES | FC(F)(F)c1ccn(-c2nc(Cl)nnc2Cl)n1 |
| InChI | InChI=1S/C7H2Cl2F3N5/c8-4-5(13-6(9)15-14-4)17-2-1-3(16-17)7(10,11)12/h1-2H |
| InChIKey | XIAUPIOPTJGYAV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.03 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,6-dichloro-5-[3-(trifluoromethyl)pyrazol-1-yl]-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dichloro-5-[3-(trifluoromethyl)pyrazol-1-yl]-1,2,4-triazine?
The IUPAC name of 3,6-dichloro-5-[3-(trifluoromethyl)pyrazol-1-yl]-1,2,4-triazine (CID 81036576) is 3,6-dichloro-5-[3-(trifluoromethyl)pyrazol-1-yl]-1,2,4-triazine.
What is the SMILES notation for 3,6-dichloro-5-[3-(trifluoromethyl)pyrazol-1-yl]-1,2,4-triazine?
The canonical SMILES for 3,6-dichloro-5-[3-(trifluoromethyl)pyrazol-1-yl]-1,2,4-triazine is FC(F)(F)c1ccn(-c2nc(Cl)nnc2Cl)n1.
What is the InChIKey of 3,6-dichloro-5-[3-(trifluoromethyl)pyrazol-1-yl]-1,2,4-triazine?
The InChIKey is XIAUPIOPTJGYAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2Cl2F3N5/c8-4-5(13-6(9)15-14-4)17-2-1-3(16-17)7(10,11)12/h1-2H.
What are the key properties of 3,6-dichloro-5-[3-(trifluoromethyl)pyrazol-1-yl]-1,2,4-triazine?
3,6-dichloro-5-[3-(trifluoromethyl)pyrazol-1-yl]-1,2,4-triazine has a molecular weight of 284.03 g/mol, XLogP of 2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dichloro-5-[3-(trifluoromethyl)pyrazol-1-yl]-1,2,4-triazine is sourced from PubChem (CID 81036576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).