C7H10Cl2N4 — CID 81037133
N-butyl-3,6-dichloro-1,2,4-triazin-5-amine (PubChem CID 81037133) has the molecular formula C7H10Cl2N4 and a molecular weight of 221.09 g/mol. Its IUPAC name is N-butyl-3,6-dichloro-1,2,4-triazin-5-amine.
| Compound Name | N-butyl-3,6-dichloro-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 81037133 |
| Molecular Formula | C7H10Cl2N4 |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | N-butyl-3,6-dichloro-1,2,4-triazin-5-amine |
| SMILES | CCCCNc1nc(Cl)nnc1Cl |
| InChI | InChI=1S/C7H10Cl2N4/c1-2-3-4-10-6-5(8)12-13-7(9)11-6/h2-4H2,1H3,(H,10,11,13) |
| InChIKey | TXNLOHHUOQQVIM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|