C15H20Cl2N4 — CID 81037312
N-[1-(1-adamantyl)ethyl]-3,6-dichloro-1,2,4-triazin-5-amine (PubChem CID 81037312) has the molecular formula C15H20Cl2N4 and a molecular weight of 327.26 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-3,6-dichloro-1,2,4-triazin-5-amine.
| Compound Name | N-[1-(1-adamantyl)ethyl]-3,6-dichloro-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 81037312 |
| Molecular Formula | C15H20Cl2N4 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-3,6-dichloro-1,2,4-triazin-5-amine |
| SMILES | CC(Nc1nc(Cl)nnc1Cl)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H20Cl2N4/c1-8(18-13-12(16)20-21-14(17)19-13)15-5-9-2-10(6-15)4-11(3-9)7-15/h8-11H,2-7H2,1H3,(H,18,19,21) |
| InChIKey | PKQZQJKILJZPKV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |