C5H6Cl2N4O — CID 81037352
2-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]ethanol (PubChem CID 81037352) has the molecular formula C5H6Cl2N4O and a molecular weight of 209.04 g/mol. Its IUPAC name is 2-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]ethanol.
| Compound Name | 2-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]ethanol |
|---|---|
| PubChem CID | 81037352 |
| Molecular Formula | C5H6Cl2N4O |
| Molecular Weight | 209.04 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | 2-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]ethanol |
| SMILES | OCCNc1nc(Cl)nnc1Cl |
| InChI | InChI=1S/C5H6Cl2N4O/c6-3-4(8-1-2-12)9-5(7)11-10-3/h12H,1-2H2,(H,8,9,11) |
| InChIKey | VKSZECVRMXBOEY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.04 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |