C13H17F3N4O — CID 81037747
4-[cyclopropyl(2,2,2-trifluoroethyl)amino]-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide (PubChem CID 81037747) has the molecular formula C13H17F3N4O and a molecular weight of 302.30 g/mol. Its IUPAC name is 4-[cyclopropyl(2,2,2-trifluoroethyl)amino]-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide.
| Compound Name | 4-[cyclopropyl(2,2,2-trifluoroethyl)amino]-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 81037747 |
| Molecular Formula | C13H17F3N4O |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 4-[cyclopropyl(2,2,2-trifluoroethyl)amino]-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide |
| SMILES | Cc1cc(N(CC(F)(F)F)C2CC2)c(/C(N)=N/O)c(C)n1 |
| InChI | InChI=1S/C13H17F3N4O/c1-7-5-10(11(8(2)18-7)12(17)19-21)20(9-3-4-9)6-13(14,15)16/h5,9,21H,3-4,6H2,1-2H3,(H2,17,19) |
| InChIKey | JYKQSBUAJCRZAW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|