C10H12Cl2N4O — CID 81037990
4-(3,6-dichloro-1,2,4-triazin-5-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 81037990) has the molecular formula C10H12Cl2N4O and a molecular weight of 275.14 g/mol. Its IUPAC name is 4-(3,6-dichloro-1,2,4-triazin-5-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | 4-(3,6-dichloro-1,2,4-triazin-5-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 81037990 |
| Molecular Formula | C10H12Cl2N4O |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 4-(3,6-dichloro-1,2,4-triazin-5-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | Clc1nnc(Cl)c(N2CCOC3CCCC32)n1 |
| InChI | InChI=1S/C10H12Cl2N4O/c11-8-9(13-10(12)15-14-8)16-4-5-17-7-3-1-2-6(7)16/h6-7H,1-5H2 |
| InChIKey | ZZSACNOLWKSIJL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |