C6H8Cl2N4O — CID 81038146
3-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]propan-1-ol (PubChem CID 81038146) has the molecular formula C6H8Cl2N4O and a molecular weight of 223.06 g/mol. Its IUPAC name is 3-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]propan-1-ol.
| Compound Name | 3-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 81038146 |
| Molecular Formula | C6H8Cl2N4O |
| Molecular Weight | 223.06 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | 3-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]propan-1-ol |
| SMILES | OCCCNc1nc(Cl)nnc1Cl |
| InChI | InChI=1S/C6H8Cl2N4O/c7-4-5(9-2-1-3-13)10-6(8)12-11-4/h13H,1-3H2,(H,9,10,12) |
| InChIKey | YYPKGYNRDXJSSP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.06 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|