C11H17NO2S2 — CID 81038590
N-[(1,1-dioxothiolan-2-yl)methyl]-1-thiophen-3-ylethanamine (PubChem CID 81038590) has the molecular formula C11H17NO2S2 and a molecular weight of 259.40 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-2-yl)methyl]-1-thiophen-3-ylethanamine.
| Compound Name | N-[(1,1-dioxothiolan-2-yl)methyl]-1-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 81038590 |
| Molecular Formula | C11H17NO2S2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | N-[(1,1-dioxothiolan-2-yl)methyl]-1-thiophen-3-ylethanamine |
| SMILES | CC(NCC1CCCS1(=O)=O)c1ccsc1 |
| InChI | InChI=1S/C11H17NO2S2/c1-9(10-4-5-15-8-10)12-7-11-3-2-6-16(11,13)14/h4-5,8-9,11-12H,2-3,6-7H2,1H3 |
| InChIKey | IRZWFUCXFSVNLC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |