About 3-(4-bromophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]cyclobutan-1-amine
3-(4-bromophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]cyclobutan-1-amine (PubChem CID 81038703) has the molecular formula C15H20BrNO2S
and a molecular weight of 358.30 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]cyclobutan-1-amine.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]cyclobutan-1-amine |
| PubChem CID | 81038703 |
| Molecular Formula | C15H20BrNO2S |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 3-(4-bromophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]cyclobutan-1-amine |
| SMILES | O=S1(=O)CCCC1CNC1CC(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C15H20BrNO2S/c16-13-5-3-11(4-6-13)12-8-14(9-12)17-10-15-2-1-7-20(15,18)19/h3-6,12,14-15,17H,1-2,7-10H2 |
| InChIKey | PJDJKLNNGVEPFB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-bromophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]cyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]cyclobutan-1-amine?
The IUPAC name of 3-(4-bromophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]cyclobutan-1-amine (CID 81038703) is 3-(4-bromophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]cyclobutan-1-amine.
What is the SMILES notation for 3-(4-bromophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]cyclobutan-1-amine?
The canonical SMILES for 3-(4-bromophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]cyclobutan-1-amine is O=S1(=O)CCCC1CNC1CC(c2ccc(Br)cc2)C1.
What is the InChIKey of 3-(4-bromophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]cyclobutan-1-amine?
The InChIKey is PJDJKLNNGVEPFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20BrNO2S/c16-13-5-3-11(4-6-13)12-8-14(9-12)17-10-15-2-1-7-20(15,18)19/h3-6,12,14-15,17H,1-2,7-10H2.
What are the key properties of 3-(4-bromophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]cyclobutan-1-amine?
3-(4-bromophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]cyclobutan-1-amine has a molecular weight of 358.30 g/mol, XLogP of 2.86, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]cyclobutan-1-amine is sourced from PubChem (CID 81038703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).