About 2-tert-butyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine
2-tert-butyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine (PubChem CID 81038779) has the molecular formula C15H29NO2S
and a molecular weight of 287.47 g/mol. Its IUPAC name is 2-tert-butyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine.
Molecular Properties
| Compound Name | 2-tert-butyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine |
| PubChem CID | 81038779 |
| Molecular Formula | C15H29NO2S |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 2-tert-butyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine |
| SMILES | CC(C)(C)C1CCCCC1NCC1CCCS1(=O)=O |
| InChI | InChI=1S/C15H29NO2S/c1-15(2,3)13-8-4-5-9-14(13)16-11-12-7-6-10-19(12,17)18/h12-14,16H,4-11H2,1-3H3 |
| InChIKey | VSQFVYHDXYEOET-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine?
The IUPAC name of 2-tert-butyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine (CID 81038779) is 2-tert-butyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine.
What is the SMILES notation for 2-tert-butyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine?
The canonical SMILES for 2-tert-butyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine is CC(C)(C)C1CCCCC1NCC1CCCS1(=O)=O.
What is the InChIKey of 2-tert-butyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine?
The InChIKey is VSQFVYHDXYEOET-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO2S/c1-15(2,3)13-8-4-5-9-14(13)16-11-12-7-6-10-19(12,17)18/h12-14,16H,4-11H2,1-3H3.
What are the key properties of 2-tert-butyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine?
2-tert-butyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine has a molecular weight of 287.47 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine is sourced from PubChem (CID 81038779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).