C13H19NO5S — CID 81039281
6-[(1,1-dioxothiolan-2-yl)methylcarbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 81039281) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 6-[(1,1-dioxothiolan-2-yl)methylcarbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[(1,1-dioxothiolan-2-yl)methylcarbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 81039281 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 6-[(1,1-dioxothiolan-2-yl)methylcarbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=CCC1C(=O)NCC1CCCS1(=O)=O |
| InChI | InChI=1S/C13H19NO5S/c15-12(10-5-1-2-6-11(10)13(16)17)14-8-9-4-3-7-20(9,18)19/h1-2,9-11H,3-8H2,(H,14,15)(H,16,17) |
| InChIKey | INJIFMZROBEAEP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|