About N-[(1,1-dioxothiolan-2-yl)methyl]thian-4-amine
N-[(1,1-dioxothiolan-2-yl)methyl]thian-4-amine (PubChem CID 81039391) has the molecular formula C10H19NO2S2
and a molecular weight of 249.40 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-2-yl)methyl]thian-4-amine.
Molecular Properties
| Compound Name | N-[(1,1-dioxothiolan-2-yl)methyl]thian-4-amine |
| PubChem CID | 81039391 |
| Molecular Formula | C10H19NO2S2 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | N-[(1,1-dioxothiolan-2-yl)methyl]thian-4-amine |
| SMILES | O=S1(=O)CCCC1CNC1CCSCC1 |
| InChI | InChI=1S/C10H19NO2S2/c12-15(13)7-1-2-10(15)8-11-9-3-5-14-6-4-9/h9-11H,1-8H2 |
| InChIKey | ALOCANOTGFTBSX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1,1-dioxothiolan-2-yl)methyl]thian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,1-dioxothiolan-2-yl)methyl]thian-4-amine?
The IUPAC name of N-[(1,1-dioxothiolan-2-yl)methyl]thian-4-amine (CID 81039391) is N-[(1,1-dioxothiolan-2-yl)methyl]thian-4-amine.
What is the SMILES notation for N-[(1,1-dioxothiolan-2-yl)methyl]thian-4-amine?
The canonical SMILES for N-[(1,1-dioxothiolan-2-yl)methyl]thian-4-amine is O=S1(=O)CCCC1CNC1CCSCC1.
What is the InChIKey of N-[(1,1-dioxothiolan-2-yl)methyl]thian-4-amine?
The InChIKey is ALOCANOTGFTBSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2S2/c12-15(13)7-1-2-10(15)8-11-9-3-5-14-6-4-9/h9-11H,1-8H2.
What are the key properties of N-[(1,1-dioxothiolan-2-yl)methyl]thian-4-amine?
N-[(1,1-dioxothiolan-2-yl)methyl]thian-4-amine has a molecular weight of 249.40 g/mol, XLogP of 1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,1-dioxothiolan-2-yl)methyl]thian-4-amine is sourced from PubChem (CID 81039391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).