C8H13N3O2S2 — CID 81039417
methyl N-cyano-N'-[(1,1-dioxothiolan-2-yl)methyl]carbamimidothioate (PubChem CID 81039417) has the molecular formula C8H13N3O2S2 and a molecular weight of 247.34 g/mol. Its IUPAC name is methyl N-cyano-N'-[(1,1-dioxothiolan-2-yl)methyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[(1,1-dioxothiolan-2-yl)methyl]carbamimidothioate |
|---|---|
| PubChem CID | 81039417 |
| Molecular Formula | C8H13N3O2S2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | methyl N-cyano-N'-[(1,1-dioxothiolan-2-yl)methyl]carbamimidothioate |
| SMILES | CS/C(=N\CC1CCCS1(=O)=O)NC#N |
| InChI | InChI=1S/C8H13N3O2S2/c1-14-8(11-6-9)10-5-7-3-2-4-15(7,12)13/h7H,2-5H2,1H3,(H,10,11) |
| InChIKey | LKBMDXVNMIVPFG-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 82.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|