C12H14N4O2S2 — CID 81039885
4-[(1,1-dioxothiolan-2-yl)methyl]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione (PubChem CID 81039885) has the molecular formula C12H14N4O2S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-2-yl)methyl]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(1,1-dioxothiolan-2-yl)methyl]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 81039885 |
| Molecular Formula | C12H14N4O2S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 4-[(1,1-dioxothiolan-2-yl)methyl]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
| SMILES | O=S1(=O)CCCC1Cn1c(-c2ccncc2)n[nH]c1=S |
| InChI | InChI=1S/C12H14N4O2S2/c17-20(18)7-1-2-10(20)8-16-11(14-15-12(16)19)9-3-5-13-6-4-9/h3-6,10H,1-2,7-8H2,(H,15,19) |
| InChIKey | FKKKMMXBAALJFI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|