About N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitropyridin-4-amine
N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitropyridin-4-amine (PubChem CID 81039958) has the molecular formula C10H13N3O4S
and a molecular weight of 271.30 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitropyridin-4-amine.
Molecular Properties
| Compound Name | N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitropyridin-4-amine |
| PubChem CID | 81039958 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitropyridin-4-amine |
| SMILES | O=[N+]([O-])c1cnccc1NCC1CCCS1(=O)=O |
| InChI | InChI=1S/C10H13N3O4S/c14-13(15)10-7-11-4-3-9(10)12-6-8-2-1-5-18(8,16)17/h3-4,7-8H,1-2,5-6H2,(H,11,12) |
| InChIKey | KIUFGOIXZJSUNU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitropyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitropyridin-4-amine?
The IUPAC name of N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitropyridin-4-amine (CID 81039958) is N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitropyridin-4-amine.
What is the SMILES notation for N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitropyridin-4-amine?
The canonical SMILES for N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitropyridin-4-amine is O=[N+]([O-])c1cnccc1NCC1CCCS1(=O)=O.
What is the InChIKey of N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitropyridin-4-amine?
The InChIKey is KIUFGOIXZJSUNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O4S/c14-13(15)10-7-11-4-3-9(10)12-6-8-2-1-5-18(8,16)17/h3-4,7-8H,1-2,5-6H2,(H,11,12).
What are the key properties of N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitropyridin-4-amine?
N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitropyridin-4-amine has a molecular weight of 271.30 g/mol, XLogP of 0.98, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitropyridin-4-amine is sourced from PubChem (CID 81039958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).