About 1-[(1,1-dioxothiolan-2-yl)methyl]-6-fluorobenzimidazol-2-amine
1-[(1,1-dioxothiolan-2-yl)methyl]-6-fluorobenzimidazol-2-amine (PubChem CID 81040051) has the molecular formula C12H14FN3O2S
and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-2-yl)methyl]-6-fluorobenzimidazol-2-amine.
Molecular Properties
| Compound Name | 1-[(1,1-dioxothiolan-2-yl)methyl]-6-fluorobenzimidazol-2-amine |
| PubChem CID | 81040051 |
| Molecular Formula | C12H14FN3O2S |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 1-[(1,1-dioxothiolan-2-yl)methyl]-6-fluorobenzimidazol-2-amine |
| SMILES | Nc1nc2ccc(F)cc2n1CC1CCCS1(=O)=O |
| InChI | InChI=1S/C12H14FN3O2S/c13-8-3-4-10-11(6-8)16(12(14)15-10)7-9-2-1-5-19(9,17)18/h3-4,6,9H,1-2,5,7H2,(H2,14,15) |
| InChIKey | SWVHQORZOGVKDD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(1,1-dioxothiolan-2-yl)methyl]-6-fluorobenzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,1-dioxothiolan-2-yl)methyl]-6-fluorobenzimidazol-2-amine?
The IUPAC name of 1-[(1,1-dioxothiolan-2-yl)methyl]-6-fluorobenzimidazol-2-amine (CID 81040051) is 1-[(1,1-dioxothiolan-2-yl)methyl]-6-fluorobenzimidazol-2-amine.
What is the SMILES notation for 1-[(1,1-dioxothiolan-2-yl)methyl]-6-fluorobenzimidazol-2-amine?
The canonical SMILES for 1-[(1,1-dioxothiolan-2-yl)methyl]-6-fluorobenzimidazol-2-amine is Nc1nc2ccc(F)cc2n1CC1CCCS1(=O)=O.
What is the InChIKey of 1-[(1,1-dioxothiolan-2-yl)methyl]-6-fluorobenzimidazol-2-amine?
The InChIKey is SWVHQORZOGVKDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FN3O2S/c13-8-3-4-10-11(6-8)16(12(14)15-10)7-9-2-1-5-19(9,17)18/h3-4,6,9H,1-2,5,7H2,(H2,14,15).
What are the key properties of 1-[(1,1-dioxothiolan-2-yl)methyl]-6-fluorobenzimidazol-2-amine?
1-[(1,1-dioxothiolan-2-yl)methyl]-6-fluorobenzimidazol-2-amine has a molecular weight of 283.33 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,1-dioxothiolan-2-yl)methyl]-6-fluorobenzimidazol-2-amine is sourced from PubChem (CID 81040051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).