C8H10N2O5S — CID 81040609
1-[(1,1-dioxothiolan-2-yl)methyl]imidazolidine-2,4,5-trione (PubChem CID 81040609) has the molecular formula C8H10N2O5S and a molecular weight of 246.24 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-2-yl)methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-[(1,1-dioxothiolan-2-yl)methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 81040609 |
| Molecular Formula | C8H10N2O5S |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 1-[(1,1-dioxothiolan-2-yl)methyl]imidazolidine-2,4,5-trione |
| SMILES | O=C1NC(=O)N(CC2CCCS2(=O)=O)C1=O |
| InChI | InChI=1S/C8H10N2O5S/c11-6-7(12)10(8(13)9-6)4-5-2-1-3-16(5,14)15/h5H,1-4H2,(H,9,11,13) |
| InChIKey | RQDZOMSHFFEGTC-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|