C12H15FN2O4S — CID 81040864
1-(1,1-dioxothiolan-2-yl)-N-[(3-fluoro-4-nitrophenyl)methyl]methanamine (PubChem CID 81040864) has the molecular formula C12H15FN2O4S and a molecular weight of 302.33 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-2-yl)-N-[(3-fluoro-4-nitrophenyl)methyl]methanamine.
| Compound Name | 1-(1,1-dioxothiolan-2-yl)-N-[(3-fluoro-4-nitrophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 81040864 |
| Molecular Formula | C12H15FN2O4S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 1-(1,1-dioxothiolan-2-yl)-N-[(3-fluoro-4-nitrophenyl)methyl]methanamine |
| SMILES | O=[N+]([O-])c1ccc(CNCC2CCCS2(=O)=O)cc1F |
| InChI | InChI=1S/C12H15FN2O4S/c13-11-6-9(3-4-12(11)15(16)17)7-14-8-10-2-1-5-20(10,18)19/h3-4,6,10,14H,1-2,5,7-8H2 |
| InChIKey | HYZLZWHUJCYTAH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|