About 6-oxo-1-pyrazin-2-yl-4,5-dihydropyridazine-3-carboxylic acid
6-oxo-1-pyrazin-2-yl-4,5-dihydropyridazine-3-carboxylic acid (PubChem CID 81042683) has the molecular formula C9H8N4O3
and a molecular weight of 220.19 g/mol. Its IUPAC name is 6-oxo-1-pyrazin-2-yl-4,5-dihydropyridazine-3-carboxylic acid.
Analyze 6-oxo-1-pyrazin-2-yl-4,5-dihydropyridazine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-1-pyrazin-2-yl-4,5-dihydropyridazine-3-carboxylic acid?
The IUPAC name of 6-oxo-1-pyrazin-2-yl-4,5-dihydropyridazine-3-carboxylic acid (CID 81042683) is 6-oxo-1-pyrazin-2-yl-4,5-dihydropyridazine-3-carboxylic acid.
What is the SMILES notation for 6-oxo-1-pyrazin-2-yl-4,5-dihydropyridazine-3-carboxylic acid?
The canonical SMILES for 6-oxo-1-pyrazin-2-yl-4,5-dihydropyridazine-3-carboxylic acid is O=C(O)C1=NN(c2cnccn2)C(=O)CC1.
What is the InChIKey of 6-oxo-1-pyrazin-2-yl-4,5-dihydropyridazine-3-carboxylic acid?
The InChIKey is AWDVUUDQIDHNFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O3/c14-8-2-1-6(9(15)16)12-13(8)7-5-10-3-4-11-7/h3-5H,1-2H2,(H,15,16).
What are the key properties of 6-oxo-1-pyrazin-2-yl-4,5-dihydropyridazine-3-carboxylic acid?
6-oxo-1-pyrazin-2-yl-4,5-dihydropyridazine-3-carboxylic acid has a molecular weight of 220.19 g/mol, XLogP of 0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-1-pyrazin-2-yl-4,5-dihydropyridazine-3-carboxylic acid is sourced from PubChem (CID 81042683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).