C16H33N3 — CID 81045799
N,N-dimethyl-1-(3-piperidin-3-ylbutyl)piperidin-3-amine (PubChem CID 81045799) has the molecular formula C16H33N3 and a molecular weight of 267.46 g/mol. Its IUPAC name is N,N-dimethyl-1-(3-piperidin-3-ylbutyl)piperidin-3-amine.
| Compound Name | N,N-dimethyl-1-(3-piperidin-3-ylbutyl)piperidin-3-amine |
|---|---|
| PubChem CID | 81045799 |
| Molecular Formula | C16H33N3 |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.27 |
| IUPAC Name | N,N-dimethyl-1-(3-piperidin-3-ylbutyl)piperidin-3-amine |
| SMILES | CC(CCN1CCCC(N(C)C)C1)C1CCCNC1 |
| InChI | InChI=1S/C16H33N3/c1-14(15-6-4-9-17-12-15)8-11-19-10-5-7-16(13-19)18(2)3/h14-17H,4-13H2,1-3H3 |
| InChIKey | CWHANCPNJNGXFY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |