About methyl 2-[(1,1-dioxothiolan-2-yl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate
methyl 2-[(1,1-dioxothiolan-2-yl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 81046617) has the molecular formula C11H16N2O4S2
and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl 2-[(1,1-dioxothiolan-2-yl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[(1,1-dioxothiolan-2-yl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 81046617 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | methyl 2-[(1,1-dioxothiolan-2-yl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(NCC2CCCS2(=O)=O)nc1C |
| InChI | InChI=1S/C11H16N2O4S2/c1-7-9(10(14)17-2)18-11(13-7)12-6-8-4-3-5-19(8,15)16/h8H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | JYXZEHYVZGAYBH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[(1,1-dioxothiolan-2-yl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1,1-dioxothiolan-2-yl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate?
The IUPAC name of methyl 2-[(1,1-dioxothiolan-2-yl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate (CID 81046617) is methyl 2-[(1,1-dioxothiolan-2-yl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for methyl 2-[(1,1-dioxothiolan-2-yl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for methyl 2-[(1,1-dioxothiolan-2-yl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate is COC(=O)c1sc(NCC2CCCS2(=O)=O)nc1C.
What is the InChIKey of methyl 2-[(1,1-dioxothiolan-2-yl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate?
The InChIKey is JYXZEHYVZGAYBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O4S2/c1-7-9(10(14)17-2)18-11(13-7)12-6-8-4-3-5-19(8,15)16/h8H,3-6H2,1-2H3,(H,12,13).
What are the key properties of methyl 2-[(1,1-dioxothiolan-2-yl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate?
methyl 2-[(1,1-dioxothiolan-2-yl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate has a molecular weight of 304.39 g/mol, XLogP of 1.23, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1,1-dioxothiolan-2-yl)methylamino]-4-methyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 81046617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).