C13H21NO3 — CID 81046628
3-[1-[(E)-but-2-enoyl]piperidin-3-yl]butanoic acid (PubChem CID 81046628) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 3-[1-[(E)-but-2-enoyl]piperidin-3-yl]butanoic acid.
| Compound Name | 3-[1-[(E)-but-2-enoyl]piperidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 81046628 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 3-[1-[(E)-but-2-enoyl]piperidin-3-yl]butanoic acid |
| SMILES | C/C=C/C(=O)N1CCCC(C(C)CC(=O)O)C1 |
| InChI | InChI=1S/C13H21NO3/c1-3-5-12(15)14-7-4-6-11(9-14)10(2)8-13(16)17/h3,5,10-11H,4,6-9H2,1-2H3,(H,16,17)/b5-3+ |
| InChIKey | IQKCPLDAQNBINW-HWKANZROSA-N |
| XLogP | 1.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|