C14H18ClNO4 — CID 81046996
3-[1-(5-chlorofuran-2-carbonyl)piperidin-3-yl]butanoic acid (PubChem CID 81046996) has the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. Its IUPAC name is 3-[1-(5-chlorofuran-2-carbonyl)piperidin-3-yl]butanoic acid.
| Compound Name | 3-[1-(5-chlorofuran-2-carbonyl)piperidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 81046996 |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3-[1-(5-chlorofuran-2-carbonyl)piperidin-3-yl]butanoic acid |
| SMILES | CC(CC(=O)O)C1CCCN(C(=O)c2ccc(Cl)o2)C1 |
| InChI | InChI=1S/C14H18ClNO4/c1-9(7-13(17)18)10-3-2-6-16(8-10)14(19)11-4-5-12(15)20-11/h4-5,9-10H,2-3,6-8H2,1H3,(H,17,18) |
| InChIKey | ULCHCSNWEUBMRP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |