About N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinylpyrimidin-4-amine
N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinylpyrimidin-4-amine (PubChem CID 81047067) has the molecular formula C9H15N5O2S
and a molecular weight of 257.32 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinylpyrimidin-4-amine |
| PubChem CID | 81047067 |
| Molecular Formula | C9H15N5O2S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinylpyrimidin-4-amine |
| SMILES | NNc1cc(NCC2CCCS2(=O)=O)ncn1 |
| InChI | InChI=1S/C9H15N5O2S/c10-14-9-4-8(12-6-13-9)11-5-7-2-1-3-17(7,15)16/h4,6-7H,1-3,5,10H2,(H2,11,12,13,14) |
| InChIKey | RGEGDONAGAFTJS-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinylpyrimidin-4-amine?
The IUPAC name of N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinylpyrimidin-4-amine (CID 81047067) is N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinylpyrimidin-4-amine.
What is the SMILES notation for N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinylpyrimidin-4-amine?
The canonical SMILES for N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinylpyrimidin-4-amine is NNc1cc(NCC2CCCS2(=O)=O)ncn1.
What is the InChIKey of N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinylpyrimidin-4-amine?
The InChIKey is RGEGDONAGAFTJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O2S/c10-14-9-4-8(12-6-13-9)11-5-7-2-1-3-17(7,15)16/h4,6-7H,1-3,5,10H2,(H2,11,12,13,14).
What are the key properties of N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinylpyrimidin-4-amine?
N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinylpyrimidin-4-amine has a molecular weight of 257.32 g/mol, XLogP of -0.25, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinylpyrimidin-4-amine is sourced from PubChem (CID 81047067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).