C14H21N3O3S — CID 81047677
3-[1-(1,3-thiazol-2-ylmethylcarbamoyl)piperidin-3-yl]butanoic acid (PubChem CID 81047677) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 3-[1-(1,3-thiazol-2-ylmethylcarbamoyl)piperidin-3-yl]butanoic acid.
| Compound Name | 3-[1-(1,3-thiazol-2-ylmethylcarbamoyl)piperidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 81047677 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-[1-(1,3-thiazol-2-ylmethylcarbamoyl)piperidin-3-yl]butanoic acid |
| SMILES | CC(CC(=O)O)C1CCCN(C(=O)NCc2nccs2)C1 |
| InChI | InChI=1S/C14H21N3O3S/c1-10(7-13(18)19)11-3-2-5-17(9-11)14(20)16-8-12-15-4-6-21-12/h4,6,10-11H,2-3,5,7-9H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | RBXCXNNRIJOFCT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |