C17H27N3O — CID 81047905
3-piperidin-3-yl-1-[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]butan-1-one (PubChem CID 81047905) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 3-piperidin-3-yl-1-[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]butan-1-one.
| Compound Name | 3-piperidin-3-yl-1-[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 81047905 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 3-piperidin-3-yl-1-[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]butan-1-one |
| SMILES | CC(CC(=O)N1CCCC1c1ccc[nH]1)C1CCCNC1 |
| InChI | InChI=1S/C17H27N3O/c1-13(14-5-2-8-18-12-14)11-17(21)20-10-4-7-16(20)15-6-3-9-19-15/h3,6,9,13-14,16,18-19H,2,4-5,7-8,10-12H2,1H3 |
| InChIKey | UCLAOEBFJHTQDC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |