About N-[2-(5,7-difluoro-1-benzothiophen-3-yl)ethyl]cyclopropanamine
N-[2-(5,7-difluoro-1-benzothiophen-3-yl)ethyl]cyclopropanamine (PubChem CID 81048547) has the molecular formula C13H13F2NS
and a molecular weight of 253.32 g/mol. Its IUPAC name is N-[2-(5,7-difluoro-1-benzothiophen-3-yl)ethyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[2-(5,7-difluoro-1-benzothiophen-3-yl)ethyl]cyclopropanamine |
| PubChem CID | 81048547 |
| Molecular Formula | C13H13F2NS |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | N-[2-(5,7-difluoro-1-benzothiophen-3-yl)ethyl]cyclopropanamine |
| SMILES | Fc1cc(F)c2scc(CCNC3CC3)c2c1 |
| InChI | InChI=1S/C13H13F2NS/c14-9-5-11-8(3-4-16-10-1-2-10)7-17-13(11)12(15)6-9/h5-7,10,16H,1-4H2 |
| InChIKey | LMFPCCRZTXJDCN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(5,7-difluoro-1-benzothiophen-3-yl)ethyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(5,7-difluoro-1-benzothiophen-3-yl)ethyl]cyclopropanamine?
The IUPAC name of N-[2-(5,7-difluoro-1-benzothiophen-3-yl)ethyl]cyclopropanamine (CID 81048547) is N-[2-(5,7-difluoro-1-benzothiophen-3-yl)ethyl]cyclopropanamine.
What is the SMILES notation for N-[2-(5,7-difluoro-1-benzothiophen-3-yl)ethyl]cyclopropanamine?
The canonical SMILES for N-[2-(5,7-difluoro-1-benzothiophen-3-yl)ethyl]cyclopropanamine is Fc1cc(F)c2scc(CCNC3CC3)c2c1.
What is the InChIKey of N-[2-(5,7-difluoro-1-benzothiophen-3-yl)ethyl]cyclopropanamine?
The InChIKey is LMFPCCRZTXJDCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F2NS/c14-9-5-11-8(3-4-16-10-1-2-10)7-17-13(11)12(15)6-9/h5-7,10,16H,1-4H2.
What are the key properties of N-[2-(5,7-difluoro-1-benzothiophen-3-yl)ethyl]cyclopropanamine?
N-[2-(5,7-difluoro-1-benzothiophen-3-yl)ethyl]cyclopropanamine has a molecular weight of 253.32 g/mol, XLogP of 3.47, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(5,7-difluoro-1-benzothiophen-3-yl)ethyl]cyclopropanamine is sourced from PubChem (CID 81048547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).