About N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine
N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine (PubChem CID 81048608) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine |
| PubChem CID | 81048608 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNCCc1coc2cc(C)c(C)cc12 |
| InChI | InChI=1S/C15H21NO/c1-4-6-16-7-5-13-10-17-15-9-12(3)11(2)8-14(13)15/h8-10,16H,4-7H2,1-3H3 |
| InChIKey | MNVWNSVJTJURIS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine?
The IUPAC name of N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine (CID 81048608) is N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine.
What is the SMILES notation for N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine?
The canonical SMILES for N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine is CCCNCCc1coc2cc(C)c(C)cc12.
What is the InChIKey of N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine?
The InChIKey is MNVWNSVJTJURIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO/c1-4-6-16-7-5-13-10-17-15-9-12(3)11(2)8-14(13)15/h8-10,16H,4-7H2,1-3H3.
What are the key properties of N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine?
N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine has a molecular weight of 231.34 g/mol, XLogP of 3.59, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine is sourced from PubChem (CID 81048608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).