C15H21NO — CID 81048608
N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine (PubChem CID 81048608) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 81048608 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | N-[2-(5,6-dimethyl-1-benzofuran-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNCCc1coc2cc(C)c(C)cc12 |
| InChI | InChI=1S/C15H21NO/c1-4-6-16-7-5-13-10-17-15-9-12(3)11(2)8-14(13)15/h8-10,16H,4-7H2,1-3H3 |
| InChIKey | MNVWNSVJTJURIS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|