C16H21F2NO2 — CID 81048636
3-[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]butanoic acid (PubChem CID 81048636) has the molecular formula C16H21F2NO2 and a molecular weight of 297.34 g/mol. Its IUPAC name is 3-[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]butanoic acid.
| Compound Name | 3-[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 81048636 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3-[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]butanoic acid |
| SMILES | CC(CC(=O)O)C1CCCN(Cc2c(F)cccc2F)C1 |
| InChI | InChI=1S/C16H21F2NO2/c1-11(8-16(20)21)12-4-3-7-19(9-12)10-13-14(17)5-2-6-15(13)18/h2,5-6,11-12H,3-4,7-10H2,1H3,(H,20,21) |
| InChIKey | PPMSKNDRZFYPJR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |