About N-methyl-1-(3,5,7-trimethyl-1-benzothiophen-2-yl)methanamine
N-methyl-1-(3,5,7-trimethyl-1-benzothiophen-2-yl)methanamine (PubChem CID 81048721) has the molecular formula C13H17NS
and a molecular weight of 219.35 g/mol. Its IUPAC name is N-methyl-1-(3,5,7-trimethyl-1-benzothiophen-2-yl)methanamine.
Molecular Properties
| Compound Name | N-methyl-1-(3,5,7-trimethyl-1-benzothiophen-2-yl)methanamine |
| PubChem CID | 81048721 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | N-methyl-1-(3,5,7-trimethyl-1-benzothiophen-2-yl)methanamine |
| SMILES | CNCc1sc2c(C)cc(C)cc2c1C |
| InChI | InChI=1S/C13H17NS/c1-8-5-9(2)13-11(6-8)10(3)12(15-13)7-14-4/h5-6,14H,7H2,1-4H3 |
| InChIKey | YHIWJJRSLPTEMK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-1-(3,5,7-trimethyl-1-benzothiophen-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(3,5,7-trimethyl-1-benzothiophen-2-yl)methanamine?
The IUPAC name of N-methyl-1-(3,5,7-trimethyl-1-benzothiophen-2-yl)methanamine (CID 81048721) is N-methyl-1-(3,5,7-trimethyl-1-benzothiophen-2-yl)methanamine.
What is the SMILES notation for N-methyl-1-(3,5,7-trimethyl-1-benzothiophen-2-yl)methanamine?
The canonical SMILES for N-methyl-1-(3,5,7-trimethyl-1-benzothiophen-2-yl)methanamine is CNCc1sc2c(C)cc(C)cc2c1C.
What is the InChIKey of N-methyl-1-(3,5,7-trimethyl-1-benzothiophen-2-yl)methanamine?
The InChIKey is YHIWJJRSLPTEMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NS/c1-8-5-9(2)13-11(6-8)10(3)12(15-13)7-14-4/h5-6,14H,7H2,1-4H3.
What are the key properties of N-methyl-1-(3,5,7-trimethyl-1-benzothiophen-2-yl)methanamine?
N-methyl-1-(3,5,7-trimethyl-1-benzothiophen-2-yl)methanamine has a molecular weight of 219.35 g/mol, XLogP of 3.55, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(3,5,7-trimethyl-1-benzothiophen-2-yl)methanamine is sourced from PubChem (CID 81048721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).