About 2-[4-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]piperazin-1-yl]-N,N-dimethylethanamine
2-[4-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]piperazin-1-yl]-N,N-dimethylethanamine (PubChem CID 81049660) has the molecular formula C16H29N5
and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-[4-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]piperazin-1-yl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[4-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]piperazin-1-yl]-N,N-dimethylethanamine |
| PubChem CID | 81049660 |
| Molecular Formula | C16H29N5 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | 2-[4-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]piperazin-1-yl]-N,N-dimethylethanamine |
| SMILES | Cc1cc(N2CCN(CCN(C)C)CC2)c(CN)c(C)n1 |
| InChI | InChI=1S/C16H29N5/c1-13-11-16(15(12-17)14(2)18-13)21-9-7-20(8-10-21)6-5-19(3)4/h11H,5-10,12,17H2,1-4H3 |
| InChIKey | XOSYTAMHQOYTFH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 48.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]piperazin-1-yl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]piperazin-1-yl]-N,N-dimethylethanamine?
The IUPAC name of 2-[4-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]piperazin-1-yl]-N,N-dimethylethanamine (CID 81049660) is 2-[4-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]piperazin-1-yl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[4-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]piperazin-1-yl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[4-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]piperazin-1-yl]-N,N-dimethylethanamine is Cc1cc(N2CCN(CCN(C)C)CC2)c(CN)c(C)n1.
What is the InChIKey of 2-[4-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]piperazin-1-yl]-N,N-dimethylethanamine?
The InChIKey is XOSYTAMHQOYTFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N5/c1-13-11-16(15(12-17)14(2)18-13)21-9-7-20(8-10-21)6-5-19(3)4/h11H,5-10,12,17H2,1-4H3.
What are the key properties of 2-[4-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]piperazin-1-yl]-N,N-dimethylethanamine?
2-[4-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]piperazin-1-yl]-N,N-dimethylethanamine has a molecular weight of 291.44 g/mol, XLogP of 0.84, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]piperazin-1-yl]-N,N-dimethylethanamine is sourced from PubChem (CID 81049660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).