C10H13FN2O4S — CID 81049854
4-fluoro-3-methoxy-N-(2-sulfamoylethyl)benzamide (PubChem CID 81049854) has the molecular formula C10H13FN2O4S and a molecular weight of 276.29 g/mol. Its IUPAC name is 4-fluoro-3-methoxy-N-(2-sulfamoylethyl)benzamide.
| Compound Name | 4-fluoro-3-methoxy-N-(2-sulfamoylethyl)benzamide |
|---|---|
| PubChem CID | 81049854 |
| Molecular Formula | C10H13FN2O4S |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 4-fluoro-3-methoxy-N-(2-sulfamoylethyl)benzamide |
| SMILES | COc1cc(C(=O)NCCS(N)(=O)=O)ccc1F |
| InChI | InChI=1S/C10H13FN2O4S/c1-17-9-6-7(2-3-8(9)11)10(14)13-4-5-18(12,15)16/h2-3,6H,4-5H2,1H3,(H,13,14)(H2,12,15,16) |
| InChIKey | NDYFLWIZONLZOS-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |