About 3-[1-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]pyrrolidin-2-yl]propan-1-ol
3-[1-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]pyrrolidin-2-yl]propan-1-ol (PubChem CID 81050229) has the molecular formula C15H25N3O
and a molecular weight of 263.38 g/mol. Its IUPAC name is 3-[1-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]pyrrolidin-2-yl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[1-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]pyrrolidin-2-yl]propan-1-ol |
| PubChem CID | 81050229 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 3-[1-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]pyrrolidin-2-yl]propan-1-ol |
| SMILES | Cc1cc(N2CCCC2CCCO)c(CN)c(C)n1 |
| InChI | InChI=1S/C15H25N3O/c1-11-9-15(14(10-16)12(2)17-11)18-7-3-5-13(18)6-4-8-19/h9,13,19H,3-8,10,16H2,1-2H3 |
| InChIKey | FJFJTCKZHRQXBU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[1-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]pyrrolidin-2-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]pyrrolidin-2-yl]propan-1-ol?
The IUPAC name of 3-[1-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]pyrrolidin-2-yl]propan-1-ol (CID 81050229) is 3-[1-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]pyrrolidin-2-yl]propan-1-ol.
What is the SMILES notation for 3-[1-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]pyrrolidin-2-yl]propan-1-ol?
The canonical SMILES for 3-[1-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]pyrrolidin-2-yl]propan-1-ol is Cc1cc(N2CCCC2CCCO)c(CN)c(C)n1.
What is the InChIKey of 3-[1-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]pyrrolidin-2-yl]propan-1-ol?
The InChIKey is FJFJTCKZHRQXBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O/c1-11-9-15(14(10-16)12(2)17-11)18-7-3-5-13(18)6-4-8-19/h9,13,19H,3-8,10,16H2,1-2H3.
What are the key properties of 3-[1-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]pyrrolidin-2-yl]propan-1-ol?
3-[1-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]pyrrolidin-2-yl]propan-1-ol has a molecular weight of 263.38 g/mol, XLogP of 1.90, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]pyrrolidin-2-yl]propan-1-ol is sourced from PubChem (CID 81050229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).