About [4-(3,3-dimethylbutoxy)-2,6-dimethyl-3-pyridinyl]methanamine
[4-(3,3-dimethylbutoxy)-2,6-dimethyl-3-pyridinyl]methanamine (PubChem CID 81050407) has the molecular formula C14H24N2O
and a molecular weight of 236.36 g/mol. Its IUPAC name is [4-(3,3-dimethylbutoxy)-2,6-dimethyl-3-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [4-(3,3-dimethylbutoxy)-2,6-dimethyl-3-pyridinyl]methanamine |
| PubChem CID | 81050407 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | [4-(3,3-dimethylbutoxy)-2,6-dimethyl-3-pyridinyl]methanamine |
| SMILES | Cc1cc(OCCC(C)(C)C)c(CN)c(C)n1 |
| InChI | InChI=1S/C14H24N2O/c1-10-8-13(12(9-15)11(2)16-10)17-7-6-14(3,4)5/h8H,6-7,9,15H2,1-5H3 |
| InChIKey | MDHWFBBWIWFVOJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(3,3-dimethylbutoxy)-2,6-dimethyl-3-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,3-dimethylbutoxy)-2,6-dimethyl-3-pyridinyl]methanamine?
The IUPAC name of [4-(3,3-dimethylbutoxy)-2,6-dimethyl-3-pyridinyl]methanamine (CID 81050407) is [4-(3,3-dimethylbutoxy)-2,6-dimethyl-3-pyridinyl]methanamine.
What is the SMILES notation for [4-(3,3-dimethylbutoxy)-2,6-dimethyl-3-pyridinyl]methanamine?
The canonical SMILES for [4-(3,3-dimethylbutoxy)-2,6-dimethyl-3-pyridinyl]methanamine is Cc1cc(OCCC(C)(C)C)c(CN)c(C)n1.
What is the InChIKey of [4-(3,3-dimethylbutoxy)-2,6-dimethyl-3-pyridinyl]methanamine?
The InChIKey is MDHWFBBWIWFVOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O/c1-10-8-13(12(9-15)11(2)16-10)17-7-6-14(3,4)5/h8H,6-7,9,15H2,1-5H3.
What are the key properties of [4-(3,3-dimethylbutoxy)-2,6-dimethyl-3-pyridinyl]methanamine?
[4-(3,3-dimethylbutoxy)-2,6-dimethyl-3-pyridinyl]methanamine has a molecular weight of 236.36 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,3-dimethylbutoxy)-2,6-dimethyl-3-pyridinyl]methanamine is sourced from PubChem (CID 81050407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).